C13H25NO2 — CID 100902002
(2S)-1-[(2S,3R)-2-(hydroxymethyl)-3-methylpiperidin-1-yl]hex-5-en-2-ol (PubChem CID 100902002) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is (2S)-1-[(2S,3R)-2-(hydroxymethyl)-3-methylpiperidin-1-yl]hex-5-en-2-ol.
| Compound Name | (2S)-1-[(2S,3R)-2-(hydroxymethyl)-3-methylpiperidin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 100902002 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (2S)-1-[(2S,3R)-2-(hydroxymethyl)-3-methylpiperidin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN1CCC[C@@H](C)[C@H]1CO |
| InChI | InChI=1S/C13H25NO2/c1-3-4-7-12(16)9-14-8-5-6-11(2)13(14)10-15/h3,11-13,15-16H,1,4-10H2,2H3/t11-,12+,13-/m1/s1 |
| InChIKey | YPBAZLVAFLAQDD-FRRDWIJNSA-N |
| XLogP | 1.41 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|