C15H27NO2 — CID 157039421
1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidin-4-ol (PubChem CID 157039421) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidin-4-ol.
| Compound Name | 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 157039421 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidin-4-ol |
| SMILES | C=CC1CCC(CN2CCC(O)CC2CO)CC1 |
| InChI | InChI=1S/C15H27NO2/c1-2-12-3-5-13(6-4-12)10-16-8-7-15(18)9-14(16)11-17/h2,12-15,17-18H,1,3-11H2 |
| InChIKey | FAUSPMBTDYFJGA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|