C14H25NO3 — CID 157039022
1-[(4-ethenylcyclohexyl)methyl]piperidine-3,4,5-triol (PubChem CID 157039022) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-[(4-ethenylcyclohexyl)methyl]piperidine-3,4,5-triol.
| Compound Name | 1-[(4-ethenylcyclohexyl)methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039022 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-[(4-ethenylcyclohexyl)methyl]piperidine-3,4,5-triol |
| SMILES | C=CC1CCC(CN2CC(O)C(O)C(O)C2)CC1 |
| InChI | InChI=1S/C14H25NO3/c1-2-10-3-5-11(6-4-10)7-15-8-12(16)14(18)13(17)9-15/h2,10-14,16-18H,1,3-9H2 |
| InChIKey | PTQXXYFTQLHSGL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|