C18H27Cl2N3O-2 — CID 10090644
4-(but-3-enylamino)-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide dichloride (PubChem CID 10090644) has the molecular formula C18H27Cl2N3O-2 and a molecular weight of 372.34 g/mol. Its IUPAC name is 4-(but-3-enylamino)-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide dichloride.
| Compound Name | 4-(but-3-enylamino)-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide dichloride |
|---|---|
| PubChem CID | 10090644 |
| Molecular Formula | C18H27Cl2N3O-2 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-(but-3-enylamino)-N-(2-pyridin-2-ylethyl)cyclohexane-1-carboxamide dichloride |
| SMILES | C=CCCNC1CCC(C(=O)NCCc2ccccn2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C18H27N3O.2ClH/c1-2-3-12-19-17-9-7-15(8-10-17)18(22)21-14-11-16-6-4-5-13-20-16;;/h2,4-6,13,15,17,19H,1,3,7-12,14H2,(H,21,22);2*1H/p-2 |
| InChIKey | OZWRZYLDZOPAAY-UHFFFAOYSA-L |
| XLogP | -3.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|