C12H20N2O4S — CID 100909732
(2S)-1-[(3S)-4-(furan-2-ylsulfonyl)-3-methylpiperazin-1-yl]propan-2-ol (PubChem CID 100909732) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is (2S)-1-[(3S)-4-(furan-2-ylsulfonyl)-3-methylpiperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[(3S)-4-(furan-2-ylsulfonyl)-3-methylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 100909732 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (2S)-1-[(3S)-4-(furan-2-ylsulfonyl)-3-methylpiperazin-1-yl]propan-2-ol |
| SMILES | C[C@H](O)CN1CCN(S(=O)(=O)c2ccco2)[C@@H](C)C1 |
| InChI | InChI=1S/C12H20N2O4S/c1-10-8-13(9-11(2)15)5-6-14(10)19(16,17)12-4-3-7-18-12/h3-4,7,10-11,15H,5-6,8-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | LAQLPLMQVXULII-QWRGUYRKSA-N |
| XLogP | 0.36 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |