C9H14N2O3S — CID 120875176
1-(furan-2-ylsulfonyl)-3-methylpiperazine (PubChem CID 120875176) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-(furan-2-ylsulfonyl)-3-methylpiperazine.
| Compound Name | 1-(furan-2-ylsulfonyl)-3-methylpiperazine |
|---|---|
| PubChem CID | 120875176 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(furan-2-ylsulfonyl)-3-methylpiperazine |
| SMILES | CC1CN(S(=O)(=O)c2ccco2)CCN1 |
| InChI | InChI=1S/C9H14N2O3S/c1-8-7-11(5-4-10-8)15(12,13)9-3-2-6-14-9/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | SUJQKWOXBXIUDK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |