C13H8Cl3FN2O3S — CID 100913416
4-chloro-N-(2,4-dichlorophenyl)-2-fluoro-5-sulfamoylbenzamide (PubChem CID 100913416) has the molecular formula C13H8Cl3FN2O3S and a molecular weight of 397.64 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dichlorophenyl)-2-fluoro-5-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-(2,4-dichlorophenyl)-2-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 100913416 |
| Molecular Formula | C13H8Cl3FN2O3S |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 4-chloro-N-(2,4-dichlorophenyl)-2-fluoro-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)Nc2ccc(Cl)cc2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C13H8Cl3FN2O3S/c14-6-1-2-11(8(15)3-6)19-13(20)7-4-12(23(18,21)22)9(16)5-10(7)17/h1-5H,(H,19,20)(H2,18,21,22) |
| InChIKey | GDEKWOOCARQFRL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |