C9H20O5Si — CID 100913639
(2S,3R,4R,5R,6S)-2-methyl-6-trimethylsilyloxyoxane-3,4,5-triol (PubChem CID 100913639) has the molecular formula C9H20O5Si and a molecular weight of 236.34 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-methyl-6-trimethylsilyloxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-methyl-6-trimethylsilyloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 100913639 |
| Molecular Formula | C9H20O5Si |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-methyl-6-trimethylsilyloxyoxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H20O5Si/c1-5-6(10)7(11)8(12)9(13-5)14-15(2,3)4/h5-12H,1-4H3/t5-,6-,7+,8+,9-/m0/s1 |
| InChIKey | JJWKYZOFMDXOSV-ABXGFROZSA-N |
| XLogP | -0.33 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|