C43H47N3O6 — CID 100914407
methyl (2S)-2-[(4S,5R)-1-(3,3-diphenylpropanoyl)-6-oxo-4-phenyl-1,7-diazaspiro[4.4]nonan-7-yl]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 100914407) has the molecular formula C43H47N3O6 and a molecular weight of 701.86 g/mol. Its IUPAC name is methyl (2S)-2-[(4S,5R)-1-(3,3-diphenylpropanoyl)-6-oxo-4-phenyl-1,7-diazaspiro[4.4]nonan-7-yl]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[(4S,5R)-1-(3,3-diphenylpropanoyl)-6-oxo-4-phenyl-1,7-diazaspiro[4.4]nonan-7-yl]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 100914407 |
| Molecular Formula | C43H47N3O6 |
| Molecular Weight | 701.86 g/mol |
| Exact Mass | 701.35 |
| IUPAC Name | methyl (2S)-2-[(4S,5R)-1-(3,3-diphenylpropanoyl)-6-oxo-4-phenyl-1,7-diazaspiro[4.4]nonan-7-yl]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)N1CC[C@]2(C1=O)[C@H](c1ccccc1)CCN2C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H47N3O6/c1-51-40(48)38(24-14-15-27-44-42(50)52-31-32-16-6-2-7-17-32)45-29-26-43(41(45)49)37(35-22-12-5-13-23-35)25-28-46(43)39(47)30-36(33-18-8-3-9-19-33)34-20-10-4-11-21-34/h2-13,16-23,36-38H,14-15,24-31H2,1H3,(H,44,50)/t37-,38-,43+/m0/s1 |
| InChIKey | DAKYFSSYRQVFOE-NQNLGNCYSA-N |
| XLogP | 6.83 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.86 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|