C23H31NO4S — CID 100916121
3-O-(4-phenylsulfanylbutyl) 5-O-propan-2-yl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 100916121) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 3-O-(4-phenylsulfanylbutyl) 5-O-propan-2-yl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(4-phenylsulfanylbutyl) 5-O-propan-2-yl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 100916121 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 3-O-(4-phenylsulfanylbutyl) 5-O-propan-2-yl 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCCSc2ccccc2)C(C)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C23H31NO4S/c1-15(2)28-23(26)21-16(3)20(17(4)24-18(21)5)22(25)27-13-9-10-14-29-19-11-7-6-8-12-19/h6-8,11-12,15-16,24H,9-10,13-14H2,1-5H3 |
| InChIKey | FUTSCROQJGLIPX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|