C16H32OSi — CID 100917080
tert-butyl-dimethyl-[(3R,6R)-3-methyl-6-propan-2-ylcyclohexen-1-yl]oxysilane (PubChem CID 100917080) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,6R)-3-methyl-6-propan-2-ylcyclohexen-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,6R)-3-methyl-6-propan-2-ylcyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 100917080 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,6R)-3-methyl-6-propan-2-ylcyclohexen-1-yl]oxysilane |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C=C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32OSi/c1-12(2)14-10-9-13(3)11-15(14)17-18(7,8)16(4,5)6/h11-14H,9-10H2,1-8H3/t13-,14-/m1/s1 |
| InChIKey | RWUXKTHOHHQGLO-ZIAGYGMSSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|