C21H19N5O4 — CID 100917779
4-(1-hydroxy-4-pyridinylidene)-13,17-dioxa-2,3,5,6-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,18,20-octaen-15-ol (PubChem CID 100917779) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 4-(1-hydroxy-4-pyridinylidene)-13,17-dioxa-2,3,5,6-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,18,20-octaen-15-ol.
| Compound Name | 4-(1-hydroxy-4-pyridinylidene)-13,17-dioxa-2,3,5,6-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,18,20-octaen-15-ol |
|---|---|
| PubChem CID | 100917779 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-(1-hydroxy-4-pyridinylidene)-13,17-dioxa-2,3,5,6-tetrazatricyclo[16.4.0.07,12]docosa-1(22),2,5,7,9,11,18,20-octaen-15-ol |
| SMILES | OC1COc2ccccc2/N=N/C(=C2C=CN(O)C=C2)/N=N/c2ccccc2OC1 |
| InChI | InChI=1S/C21H19N5O4/c27-16-13-29-19-7-3-1-5-17(19)22-24-21(15-9-11-26(28)12-10-15)25-23-18-6-2-4-8-20(18)30-14-16/h1-12,16,27-28H,13-14H2/b24-22+,25-23+ |
| InChIKey | MOKUTFUNIQAKCQ-BQASJOSNSA-N |
| XLogP | 4.63 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |