C18H18N2O3 — CID 102509722
(1R,3R)-2,5,22-trioxa-12,15-diazapentacyclo[13.8.0.03,12.06,11.016,21]tricosa-6,8,10,16,18,20-hexaene (PubChem CID 102509722) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1R,3R)-2,5,22-trioxa-12,15-diazapentacyclo[13.8.0.03,12.06,11.016,21]tricosa-6,8,10,16,18,20-hexaene.
| Compound Name | (1R,3R)-2,5,22-trioxa-12,15-diazapentacyclo[13.8.0.03,12.06,11.016,21]tricosa-6,8,10,16,18,20-hexaene |
|---|---|
| PubChem CID | 102509722 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (1R,3R)-2,5,22-trioxa-12,15-diazapentacyclo[13.8.0.03,12.06,11.016,21]tricosa-6,8,10,16,18,20-hexaene |
| SMILES | c1ccc2c(c1)OC[C@H]1O[C@@H]3COc4ccccc4N3CCN21 |
| InChI | InChI=1S/C18H18N2O3/c1-3-7-15-13(5-1)19-9-10-20-14-6-2-4-8-16(14)22-12-18(20)23-17(19)11-21-15/h1-8,17-18H,9-12H2/t17-,18-/m1/s1 |
| InChIKey | TVOCOADJJPTBCT-QZTJIDSGSA-N |
| XLogP | 2.47 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |