C18H12N6O3S — CID 10091898
3-amino-N-[(E)-(4-nitrophenyl)methylideneamino]thieno[3,2-b]quinoxaline-2-carboxamide (PubChem CID 10091898) has the molecular formula C18H12N6O3S and a molecular weight of 392.40 g/mol. Its IUPAC name is 3-amino-N-[(E)-(4-nitrophenyl)methylideneamino]thieno[3,2-b]quinoxaline-2-carboxamide.
| Compound Name | 3-amino-N-[(E)-(4-nitrophenyl)methylideneamino]thieno[3,2-b]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 10091898 |
| Molecular Formula | C18H12N6O3S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-amino-N-[(E)-(4-nitrophenyl)methylideneamino]thieno[3,2-b]quinoxaline-2-carboxamide |
| SMILES | Nc1c(C(=O)N/N=C/c2ccc([N+](=O)[O-])cc2)sc2nc3ccccc3nc12 |
| InChI | InChI=1S/C18H12N6O3S/c19-14-15-18(22-13-4-2-1-3-12(13)21-15)28-16(14)17(25)23-20-9-10-5-7-11(8-6-10)24(26)27/h1-9H,19H2,(H,23,25)/b20-9+ |
| InChIKey | RMVSPNXECZBUGZ-AWQFTUOYSA-N |
| XLogP | 3.10 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|