C30H29ClN4O4 — CID 100921831
2-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(3,3-dimethyl-5-nitro-1H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethyl-5-nitroindole (PubChem CID 100921831) has the molecular formula C30H29ClN4O4 and a molecular weight of 545.04 g/mol. Its IUPAC name is 2-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(3,3-dimethyl-5-nitro-1H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethyl-5-nitroindole.
| Compound Name | 2-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(3,3-dimethyl-5-nitro-1H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethyl-5-nitroindole |
|---|---|
| PubChem CID | 100921831 |
| Molecular Formula | C30H29ClN4O4 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(3,3-dimethyl-5-nitro-1H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethyl-5-nitroindole |
| SMILES | CC1(C)C(/C=C/C2=C(Cl)/C(=C/C=C3\Nc4ccc([N+](=O)[O-])cc4C3(C)C)CCC2)=Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C30H29ClN4O4/c1-29(2)22-16-20(34(36)37)10-12-24(22)32-26(29)14-8-18-6-5-7-19(28(18)31)9-15-27-30(3,4)23-17-21(35(38)39)11-13-25(23)33-27/h8-17,32H,5-7H2,1-4H3/b15-9+,18-8+,26-14- |
| InChIKey | KICMLGUJBOOOMD-NJJUPGNZSA-N |
| XLogP | 8.31 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|