C22H21NO4 — CID 100924372
[(1S,2S,6R,7R)-10-ethyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-10-yl] naphthalene-2-carboxylate (PubChem CID 100924372) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is [(1S,2S,6R,7R)-10-ethyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-10-yl] naphthalene-2-carboxylate.
| Compound Name | [(1S,2S,6R,7R)-10-ethyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-10-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 100924372 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [(1S,2S,6R,7R)-10-ethyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-10-yl] naphthalene-2-carboxylate |
| SMILES | CCC1(OC(=O)c2ccc3ccccc3c2)[C@@H]2CC[C@H]1[C@@H]1C(=O)NC(=O)[C@@H]12 |
| InChI | InChI=1S/C22H21NO4/c1-2-22(15-9-10-16(22)18-17(15)19(24)23-20(18)25)27-21(26)14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11,15-18H,2,9-10H2,1H3,(H,23,24,25)/t15-,16+,17-,18+,22? |
| InChIKey | NXRJFMKHIPAIQV-WFVIJZHKSA-N |
| XLogP | 3.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|