C11H8N6O4S — CID 100926768
N-(4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide (PubChem CID 100926768) has the molecular formula C11H8N6O4S and a molecular weight of 320.29 g/mol. Its IUPAC name is N-(4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide.
| Compound Name | N-(4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 100926768 |
| Molecular Formula | C11H8N6O4S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(4-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)c2nc3ncccn3n2)cc1 |
| InChI | InChI=1S/C11H8N6O4S/c18-17(19)9-4-2-8(3-5-9)15-22(20,21)11-13-10-12-6-1-7-16(10)14-11/h1-7,15H |
| InChIKey | MDQXOODHNXFWAC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|