C21H24Cl2N2O2 — CID 10092784
N-[2-[5-[(3,4-dichlorophenyl)methyl]morpholin-3-yl]ethyl]-2-phenylacetamide (PubChem CID 10092784) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is N-[2-[5-[(3,4-dichlorophenyl)methyl]morpholin-3-yl]ethyl]-2-phenylacetamide.
| Compound Name | N-[2-[5-[(3,4-dichlorophenyl)methyl]morpholin-3-yl]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10092784 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[2-[5-[(3,4-dichlorophenyl)methyl]morpholin-3-yl]ethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCCC1COCC(Cc2ccc(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c22-19-7-6-16(11-20(19)23)10-18-14-27-13-17(25-18)8-9-24-21(26)12-15-4-2-1-3-5-15/h1-7,11,17-18,25H,8-10,12-14H2,(H,24,26) |
| InChIKey | INFIDQFSFHHWOQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |