C11H16NO4P — CID 102365390
[(3R,5S)-5-benzylmorpholin-3-yl]phosphonic acid (PubChem CID 102365390) has the molecular formula C11H16NO4P and a molecular weight of 257.23 g/mol. Its IUPAC name is [(3R,5S)-5-benzylmorpholin-3-yl]phosphonic acid.
| Compound Name | [(3R,5S)-5-benzylmorpholin-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 102365390 |
| Molecular Formula | C11H16NO4P |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [(3R,5S)-5-benzylmorpholin-3-yl]phosphonic acid |
| SMILES | O=P(O)(O)[C@@H]1COC[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C11H16NO4P/c13-17(14,15)11-8-16-7-10(12-11)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2,(H2,13,14,15)/t10-,11+/m0/s1 |
| InChIKey | IBBBWNVOFWFYLO-WDEREUQCSA-N |
| XLogP | 0.72 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|