C20H34O5 — CID 100929680
diethyl 2-[(E)-3-(3-heptyloxiran-2-yl)prop-2-enyl]-2-methylpropanedioate (PubChem CID 100929680) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is diethyl 2-[(E)-3-(3-heptyloxiran-2-yl)prop-2-enyl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[(E)-3-(3-heptyloxiran-2-yl)prop-2-enyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 100929680 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | diethyl 2-[(E)-3-(3-heptyloxiran-2-yl)prop-2-enyl]-2-methylpropanedioate |
| SMILES | CCCCCCCC1OC1/C=C/CC(C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H34O5/c1-5-8-9-10-11-13-16-17(25-16)14-12-15-20(4,18(21)23-6-2)19(22)24-7-3/h12,14,16-17H,5-11,13,15H2,1-4H3/b14-12+ |
| InChIKey | WQQLMHFJFNCHET-WYMLVPIESA-N |
| XLogP | 4.19 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|