C12H21ClO — CID 11413296
(2S,3S)-2-[(E)-3-chloroprop-1-enyl]-3-heptyloxirane (PubChem CID 11413296) has the molecular formula C12H21ClO and a molecular weight of 216.75 g/mol. Its IUPAC name is (2S,3S)-2-[(E)-3-chloroprop-1-enyl]-3-heptyloxirane.
| Compound Name | (2S,3S)-2-[(E)-3-chloroprop-1-enyl]-3-heptyloxirane |
|---|---|
| PubChem CID | 11413296 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2S,3S)-2-[(E)-3-chloroprop-1-enyl]-3-heptyloxirane |
| SMILES | CCCCCCC[C@@H]1O[C@H]1/C=C/CCl |
| InChI | InChI=1S/C12H21ClO/c1-2-3-4-5-6-8-11-12(14-11)9-7-10-13/h7,9,11-12H,2-6,8,10H2,1H3/b9-7+/t11-,12-/m0/s1 |
| InChIKey | BQKSTRJSISPPEE-JONLBCGYSA-N |
| XLogP | 3.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|