C20H34O — CID 54182229
(2R,3R)-2-butyl-3-tetradeca-1,3,5-trienyloxirane (PubChem CID 54182229) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (2R,3R)-2-butyl-3-tetradeca-1,3,5-trienyloxirane.
| Compound Name | (2R,3R)-2-butyl-3-tetradeca-1,3,5-trienyloxirane |
|---|---|
| PubChem CID | 54182229 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (2R,3R)-2-butyl-3-tetradeca-1,3,5-trienyloxirane |
| SMILES | CCCCCCCCC=CC=CC=C[C@H]1O[C@@H]1CCCC |
| InChI | InChI=1S/C20H34O/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-19(21-20)17-6-4-2/h12-16,18-20H,3-11,17H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | PCPNCBZUVPDHGX-WOJBJXKFSA-N |
| XLogP | 6.36 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|