C15H14O5 — CID 100930166
(1S,6R,12R)-4,13-dimethyl-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadeca-4,9(16),13-triene-3,8-dione (PubChem CID 100930166) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is (1S,6R,12R)-4,13-dimethyl-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadeca-4,9(16),13-triene-3,8-dione.
| Compound Name | (1S,6R,12R)-4,13-dimethyl-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadeca-4,9(16),13-triene-3,8-dione |
|---|---|
| PubChem CID | 100930166 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (1S,6R,12R)-4,13-dimethyl-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadeca-4,9(16),13-triene-3,8-dione |
| SMILES | CC1=C[C@]23OC(=O)C(C)=C2[C@H]2C=C(CC[C@H]1O3)C(=O)O2 |
| InChI | InChI=1S/C15H14O5/c1-7-6-15-12(8(2)13(16)20-15)11-5-9(14(17)18-11)3-4-10(7)19-15/h5-6,10-11H,3-4H2,1-2H3/t10-,11-,15+/m1/s1 |
| InChIKey | KKAJMGUQDKSIMH-HFAKWTLXSA-N |
| XLogP | 1.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|