C20H24O6 — CID 11617447
(1S,2R,3R,9R,10R)-1,10-dihydroxy-12-methyl-2,9-bis(prop-1-en-2-yl)-4,14-dioxatricyclo[9.2.1.13,6]pentadeca-6(15),11-diene-5,13-dione (PubChem CID 11617447) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1S,2R,3R,9R,10R)-1,10-dihydroxy-12-methyl-2,9-bis(prop-1-en-2-yl)-4,14-dioxatricyclo[9.2.1.13,6]pentadeca-6(15),11-diene-5,13-dione.
| Compound Name | (1S,2R,3R,9R,10R)-1,10-dihydroxy-12-methyl-2,9-bis(prop-1-en-2-yl)-4,14-dioxatricyclo[9.2.1.13,6]pentadeca-6(15),11-diene-5,13-dione |
|---|---|
| PubChem CID | 11617447 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1S,2R,3R,9R,10R)-1,10-dihydroxy-12-methyl-2,9-bis(prop-1-en-2-yl)-4,14-dioxatricyclo[9.2.1.13,6]pentadeca-6(15),11-diene-5,13-dione |
| SMILES | C=C(C)[C@H]1CCC2=C[C@@H](OC2=O)[C@@H](C(=C)C)[C@]2(O)OC(=C(C)C2=O)[C@@H]1O |
| InChI | InChI=1S/C20H24O6/c1-9(2)13-7-6-12-8-14(25-19(12)23)15(10(3)4)20(24)18(22)11(5)17(26-20)16(13)21/h8,13-16,21,24H,1,3,6-7H2,2,4-5H3/t13-,14-,15-,16-,20+/m1/s1 |
| InChIKey | AIDLGOARWPUFNT-MQVHAOHTSA-N |
| XLogP | 1.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|