C19H15ClFNO4 — CID 100933024
2-methylpropyl 2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate (PubChem CID 100933024) has the molecular formula C19H15ClFNO4 and a molecular weight of 375.78 g/mol. Its IUPAC name is 2-methylpropyl 2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate.
| Compound Name | 2-methylpropyl 2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 100933024 |
| Molecular Formula | C19H15ClFNO4 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-methylpropyl 2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorobenzoate |
| SMILES | CC(C)COC(=O)c1cc(N2C(=O)c3ccccc3C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C19H15ClFNO4/c1-10(2)9-26-19(25)13-7-16(15(21)8-14(13)20)22-17(23)11-5-3-4-6-12(11)18(22)24/h3-8,10H,9H2,1-2H3 |
| InChIKey | MRJBPYTXPOESLA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|