C18H12Cl2FNO5 — CID 165341063
2-chloroethyl 2-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenoxy]acetate (PubChem CID 165341063) has the molecular formula C18H12Cl2FNO5 and a molecular weight of 412.20 g/mol. Its IUPAC name is 2-chloroethyl 2-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenoxy]acetate.
| Compound Name | 2-chloroethyl 2-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 165341063 |
| Molecular Formula | C18H12Cl2FNO5 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-chloroethyl 2-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenoxy]acetate |
| SMILES | O=C(COc1cc(N2C(=O)c3ccccc3C2=O)c(F)cc1Cl)OCCCl |
| InChI | InChI=1S/C18H12Cl2FNO5/c19-5-6-26-16(23)9-27-15-8-14(13(21)7-12(15)20)22-17(24)10-3-1-2-4-11(10)18(22)25/h1-4,7-8H,5-6,9H2 |
| InChIKey | BJHCIJQQGIKQPA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|