C17H9Cl3FNO3 — CID 22623295
2-chloro-3-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenyl]propanoyl chloride (PubChem CID 22623295) has the molecular formula C17H9Cl3FNO3 and a molecular weight of 400.62 g/mol. Its IUPAC name is 2-chloro-3-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenyl]propanoyl chloride.
| Compound Name | 2-chloro-3-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenyl]propanoyl chloride |
|---|---|
| PubChem CID | 22623295 |
| Molecular Formula | C17H9Cl3FNO3 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 2-chloro-3-[2-chloro-5-(1,3-dioxoisoindol-2-yl)-4-fluorophenyl]propanoyl chloride |
| SMILES | O=C(Cl)C(Cl)Cc1cc(N2C(=O)c3ccccc3C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C17H9Cl3FNO3/c18-11-7-13(21)14(6-8(11)5-12(19)15(20)23)22-16(24)9-3-1-2-4-10(9)17(22)25/h1-4,6-7,12H,5H2 |
| InChIKey | XEAVSSRIMHMJES-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|