C12H16N4O6 — CID 100933502
(2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-[(3-methoxy-2-pyridinyl)oxy]oxane-3,4-diol (PubChem CID 100933502) has the molecular formula C12H16N4O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-[(3-methoxy-2-pyridinyl)oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-[(3-methoxy-2-pyridinyl)oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 100933502 |
| Molecular Formula | C12H16N4O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-azido-2-(hydroxymethyl)-6-[(3-methoxy-2-pyridinyl)oxy]oxane-3,4-diol |
| SMILES | COc1cccnc1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H16N4O6/c1-20-6-3-2-4-14-11(6)22-12-8(15-16-13)10(19)9(18)7(5-17)21-12/h2-4,7-10,12,17-19H,5H2,1H3/t7-,8-,9+,10-,12+/m1/s1 |
| InChIKey | QKFXJNMAQHPHTR-GPTQDWHKSA-N |
| XLogP | -0.41 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|