C13H16N6O5 — CID 118040296
(2S,3S,4S,5S,6S)-3,5-diazido-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-4-ol (PubChem CID 118040296) has the molecular formula C13H16N6O5 and a molecular weight of 336.31 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-3,5-diazido-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-4-ol.
| Compound Name | (2S,3S,4S,5S,6S)-3,5-diazido-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-4-ol |
|---|---|
| PubChem CID | 118040296 |
| Molecular Formula | C13H16N6O5 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2S,3S,4S,5S,6S)-3,5-diazido-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-4-ol |
| SMILES | COc1ccc(O[C@@H]2O[C@H](CO)[C@@H](N=[N+]=[N-])[C@H](O)[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C13H16N6O5/c1-22-7-2-4-8(5-3-7)23-13-11(17-19-15)12(21)10(16-18-14)9(6-20)24-13/h2-5,9-13,20-21H,6H2,1H3/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | RDBROSXCAGXRIQ-NAWOPXAZSA-N |
| XLogP | 1.51 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|