C14H18N6O5 — CID 153286459
(2R,3S,4S,5S,6S)-3,5-diazido-6-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]oxane-2,4-diol (PubChem CID 153286459) has the molecular formula C14H18N6O5 and a molecular weight of 350.34 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-3,5-diazido-6-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]oxane-2,4-diol.
| Compound Name | (2R,3S,4S,5S,6S)-3,5-diazido-6-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]oxane-2,4-diol |
|---|---|
| PubChem CID | 153286459 |
| Molecular Formula | C14H18N6O5 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2R,3S,4S,5S,6S)-3,5-diazido-6-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]oxane-2,4-diol |
| SMILES | COc1ccc(C[C@@]2(O)O[C@H](CO)[C@@H](N=[N+]=[N-])[C@H](O)[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H18N6O5/c1-24-9-4-2-8(3-5-9)6-14(23)13(18-20-16)12(22)11(17-19-15)10(7-21)25-14/h2-5,10-13,21-23H,6-7H2,1H3/t10-,11-,12+,13+,14-/m1/s1 |
| InChIKey | JVGMNJXWYADLDT-PEBLQZBPSA-N |
| XLogP | 1.04 |
| TPSA | 176.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|