About (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione
(13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione (PubChem CID 100934797) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione.
Molecular Properties
| Compound Name | (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione |
| PubChem CID | 100934797 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione |
| SMILES | O=C1OC/C=C\CCCCCCCCOC1=O |
| InChI | InChI=1S/C13H20O4/c14-12-13(15)17-11-9-7-5-3-1-2-4-6-8-10-16-12/h6,8H,1-5,7,9-11H2/b8-6- |
| InChIKey | FLYLWEMRHVSJAV-VURMDHGXSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione?
The IUPAC name of (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione (CID 100934797) is (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione.
What is the SMILES notation for (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione?
The canonical SMILES for (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione is O=C1OC/C=C\CCCCCCCCOC1=O.
What is the InChIKey of (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione?
The InChIKey is FLYLWEMRHVSJAV-VURMDHGXSA-N. The full InChI is InChI=1S/C13H20O4/c14-12-13(15)17-11-9-7-5-3-1-2-4-6-8-10-16-12/h6,8H,1-5,7,9-11H2/b8-6-.
What are the key properties of (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione?
(13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione has a molecular weight of 240.30 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione is sourced from PubChem (CID 100934797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).