C13H20O4 — CID 100934797
(13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione (PubChem CID 100934797) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione.
| Compound Name | (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione |
|---|---|
| PubChem CID | 100934797 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (13Z)-1,4-dioxacyclopentadec-13-ene-2,3-dione |
| SMILES | O=C1OC/C=C\CCCCCCCCOC1=O |
| InChI | InChI=1S/C13H20O4/c14-12-13(15)17-11-9-7-5-3-1-2-4-6-8-10-16-12/h6,8H,1-5,7,9-11H2/b8-6- |
| InChIKey | FLYLWEMRHVSJAV-VURMDHGXSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|