C22H14ClN3O4 — CID 10093554
1,2-dibenzoyl-4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 10093554) has the molecular formula C22H14ClN3O4 and a molecular weight of 419.82 g/mol. Its IUPAC name is 1,2-dibenzoyl-4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1,2-dibenzoyl-4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 10093554 |
| Molecular Formula | C22H14ClN3O4 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1,2-dibenzoyl-4-(4-chlorophenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | O=C(c1ccccc1)n1c(=O)n(-c2ccc(Cl)cc2)c(=O)n1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H14ClN3O4/c23-17-11-13-18(14-12-17)24-21(29)25(19(27)15-7-3-1-4-8-15)26(22(24)30)20(28)16-9-5-2-6-10-16/h1-14H |
| InChIKey | KISZUNTYZTUINK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |