C19H16F3N7O5S — CID 100939346
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide (PubChem CID 100939346) has the molecular formula C19H16F3N7O5S and a molecular weight of 511.44 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide |
|---|---|
| PubChem CID | 100939346 |
| Molecular Formula | C19H16F3N7O5S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-sulfanylidene-3H-purin-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide |
| SMILES | O=C(Nc1nc(=S)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2[nH]1)c1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C19H16F3N7O5S/c20-19(21,22)18(27-28-18)8-3-1-7(2-4-8)14(33)25-17-24-13-10(15(35)26-17)23-6-29(13)16-12(32)11(31)9(5-30)34-16/h1-4,6,9,11-12,16,30-32H,5H2,(H2,24,25,26,33,35)/t9-,11-,12-,16-/m1/s1 |
| InChIKey | PODKRCWHNRCGJE-UBEDBUPSSA-N |
| XLogP | 1.53 |
| TPSA | 170.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|