C26H22Cl2N2 — CID 100939865
N',N'-bis(4-chlorophenyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 100939865) has the molecular formula C26H22Cl2N2 and a molecular weight of 433.38 g/mol. Its IUPAC name is N',N'-bis(4-chlorophenyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | N',N'-bis(4-chlorophenyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 100939865 |
| Molecular Formula | C26H22Cl2N2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N',N'-bis(4-chlorophenyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | NC(c1ccccc1)C(c1ccccc1)N(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22Cl2N2/c27-21-11-15-23(16-12-21)30(24-17-13-22(28)14-18-24)26(20-9-5-2-6-10-20)25(29)19-7-3-1-4-8-19/h1-18,25-26H,29H2 |
| InChIKey | CPBSCYQWFXTXLH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |