C20H29ClO6Si — CID 10094124
ethyl (4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)-2-oxobutanoate (PubChem CID 10094124) has the molecular formula C20H29ClO6Si and a molecular weight of 428.99 g/mol. Its IUPAC name is ethyl (4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)-2-oxobutanoate.
| Compound Name | ethyl (4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)-2-oxobutanoate |
|---|---|
| PubChem CID | 10094124 |
| Molecular Formula | C20H29ClO6Si |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | ethyl (4R)-3-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-chlorophenyl)-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)C(OC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClO6Si/c1-8-25-19(24)16(23)18(26-13(2)22)17(14-9-11-15(21)12-10-14)27-28(6,7)20(3,4)5/h9-12,17-18H,8H2,1-7H3/t17-,18?/m1/s1 |
| InChIKey | RMMHNKXMYMRNBG-QNSVNVJESA-N |
| XLogP | 4.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|