C17H21NOS2 — CID 100941251
(3'aR,5S,6'aR)-2-benzyl-4,4-dimethylspiro[1,3-thiazole-5,2'-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxathiole] (PubChem CID 100941251) has the molecular formula C17H21NOS2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (3'aR,5S,6'aR)-2-benzyl-4,4-dimethylspiro[1,3-thiazole-5,2'-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxathiole].
| Compound Name | (3'aR,5S,6'aR)-2-benzyl-4,4-dimethylspiro[1,3-thiazole-5,2'-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxathiole] |
|---|---|
| PubChem CID | 100941251 |
| Molecular Formula | C17H21NOS2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (3'aR,5S,6'aR)-2-benzyl-4,4-dimethylspiro[1,3-thiazole-5,2'-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxathiole] |
| SMILES | CC1(C)N=C(Cc2ccccc2)S[C@]12O[C@@H]1CCC[C@H]1S2 |
| InChI | InChI=1S/C17H21NOS2/c1-16(2)17(19-13-9-6-10-14(13)20-17)21-15(18-16)11-12-7-4-3-5-8-12/h3-5,7-8,13-14H,6,9-11H2,1-2H3/t13-,14-,17+/m1/s1 |
| InChIKey | AZNBLEBFDYWHMD-CPUCHLNUSA-N |
| XLogP | 4.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |