C22H25NS2 — CID 15271570
2-benzyl-5-benzylsulfanyl-4,4-dimethyl-5-prop-2-enyl-1,3-thiazole (PubChem CID 15271570) has the molecular formula C22H25NS2 and a molecular weight of 367.58 g/mol. Its IUPAC name is 2-benzyl-5-benzylsulfanyl-4,4-dimethyl-5-prop-2-enyl-1,3-thiazole.
| Compound Name | 2-benzyl-5-benzylsulfanyl-4,4-dimethyl-5-prop-2-enyl-1,3-thiazole |
|---|---|
| PubChem CID | 15271570 |
| Molecular Formula | C22H25NS2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-benzyl-5-benzylsulfanyl-4,4-dimethyl-5-prop-2-enyl-1,3-thiazole |
| SMILES | C=CCC1(SCc2ccccc2)SC(Cc2ccccc2)=NC1(C)C |
| InChI | InChI=1S/C22H25NS2/c1-4-15-22(24-17-19-13-9-6-10-14-19)21(2,3)23-20(25-22)16-18-11-7-5-8-12-18/h4-14H,1,15-17H2,2-3H3 |
| InChIKey | ICAWOFKLAHKXMH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|