C14H28F4O6P2 — CID 10094192
2-[[2-di(propan-2-yloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-propan-2-yloxyphosphoryl]oxypropane (PubChem CID 10094192) has the molecular formula C14H28F4O6P2 and a molecular weight of 430.31 g/mol. Its IUPAC name is 2-[[2-di(propan-2-yloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-propan-2-yloxyphosphoryl]oxypropane.
| Compound Name | 2-[[2-di(propan-2-yloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-propan-2-yloxyphosphoryl]oxypropane |
|---|---|
| PubChem CID | 10094192 |
| Molecular Formula | C14H28F4O6P2 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-[[2-di(propan-2-yloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-propan-2-yloxyphosphoryl]oxypropane |
| SMILES | CC(C)OP(=O)(OC(C)C)C(F)(F)C(F)(F)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C14H28F4O6P2/c1-9(2)21-25(19,22-10(3)4)13(15,16)14(17,18)26(20,23-11(5)6)24-12(7)8/h9-12H,1-8H3 |
| InChIKey | ZSZCZDHITXTCJO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|