C20H30O6 — CID 100942567
(1S,2R,6R,8R,9S)-8-[(1R,2R,3S,4S)-3-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100942567) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-8-[(1R,2R,3S,4S)-3-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-8-[(1R,2R,3S,4S)-3-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100942567 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (1S,2R,6R,8R,9S)-8-[(1R,2R,3S,4S)-3-(methoxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | COC[C@@H]1[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C20H30O6/c1-19(2)23-15-14(13-11-7-6-10(8-11)12(13)9-21-5)22-18-17(16(15)24-19)25-20(3,4)26-18/h6-7,10-18H,8-9H2,1-5H3/t10-,11+,12+,13-,14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | HWMIOEAGGSYLQC-NBSIOIPLSA-N |
| XLogP | 2.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|