C15H32O3Si — CID 100942638
[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-3-yl] acetate (PubChem CID 100942638) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-3-yl] acetate.
| Compound Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-3-yl] acetate |
|---|---|
| PubChem CID | 100942638 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylhexan-3-yl] acetate |
| SMILES | CCC[C@H](OC(C)=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3Si/c1-9-10-14(18-13(3)16)12(2)11-17-19(7,8)15(4,5)6/h12,14H,9-11H2,1-8H3/t12-,14+/m1/s1 |
| InChIKey | WWYYZIJXVLMBJP-OCCSQVGLSA-N |
| XLogP | 4.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|