C25H26N2O7 — CID 100944909
benzyl N-[(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propyl]carbamate (PubChem CID 100944909) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 100944909 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | benzyl N-[(1S,2S)-2-(1,3-dioxoisoindol-2-yl)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)propyl]carbamate |
| SMILES | C[C@@H]([C@H](NC(=O)OCc1ccccc1)C12OCC(C)(CO1)CO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H26N2O7/c1-16(27-21(28)18-10-6-7-11-19(18)22(27)29)20(25-32-13-24(2,14-33-25)15-34-25)26-23(30)31-12-17-8-4-3-5-9-17/h3-11,16,20H,12-15H2,1-2H3,(H,26,30)/t16-,20-,24?,25?/m0/s1 |
| InChIKey | MHXOBPOIQDAPBK-ZXBPBSCESA-N |
| XLogP | 2.70 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|