C22H24N4O5 — CID 10788449
benzyl N-[(1S,2S)-2-azido-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-phenylethyl]carbamate (PubChem CID 10788449) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-2-azido-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-2-azido-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 10788449 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | benzyl N-[(1S,2S)-2-azido-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-phenylethyl]carbamate |
| SMILES | CC12COC([C@@H](NC(=O)OCc3ccccc3)[C@@H](N=[N+]=[N-])c3ccccc3)(OC1)OC2 |
| InChI | InChI=1S/C22H24N4O5/c1-21-13-29-22(30-14-21,31-15-21)19(18(25-26-23)17-10-6-3-7-11-17)24-20(27)28-12-16-8-4-2-5-9-16/h2-11,18-19H,12-15H2,1H3,(H,24,27)/t18-,19-,21?,22?/m0/s1 |
| InChIKey | GGHRRMKKWWIZLK-CDNGDFIJSA-N |
| XLogP | 4.07 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|