C13H16N4O4 — CID 71762421
[1-azido-1-(phenylmethoxycarbonylamino)propan-2-yl] acetate (PubChem CID 71762421) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is [1-azido-1-(phenylmethoxycarbonylamino)propan-2-yl] acetate.
| Compound Name | [1-azido-1-(phenylmethoxycarbonylamino)propan-2-yl] acetate |
|---|---|
| PubChem CID | 71762421 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [1-azido-1-(phenylmethoxycarbonylamino)propan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(N=[N+]=[N-])NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16N4O4/c1-9(21-10(2)18)12(16-17-14)15-13(19)20-8-11-6-4-3-5-7-11/h3-7,9,12H,8H2,1-2H3,(H,15,19) |
| InChIKey | KJAAQBQWGFCKJD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|