C14H18O3 — CID 100946476
(3S,5S)-3,5-diethyl-3-hydroxy-5-phenyloxolan-2-one (PubChem CID 100946476) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3S,5S)-3,5-diethyl-3-hydroxy-5-phenyloxolan-2-one.
| Compound Name | (3S,5S)-3,5-diethyl-3-hydroxy-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 100946476 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3S,5S)-3,5-diethyl-3-hydroxy-5-phenyloxolan-2-one |
| SMILES | CC[C@]1(O)C[C@@](CC)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C14H18O3/c1-3-13(16)10-14(4-2,17-12(13)15)11-8-6-5-7-9-11/h5-9,16H,3-4,10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | XJOGKKWDEIBSOF-KBPBESRZSA-N |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |