C30H30N2O6 — CID 100946585
(1S,2S,6R,14R,15R)-11,15-dimethoxy-18-(4-methoxyphenyl)-5-methyl-13-oxa-5,18-diazaheptacyclo[13.5.2.12,8.01,6.02,14.016,20.012,23]tricosa-8(23),9,11,21-tetraene-17,19-dione (PubChem CID 100946585) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R)-11,15-dimethoxy-18-(4-methoxyphenyl)-5-methyl-13-oxa-5,18-diazaheptacyclo[13.5.2.12,8.01,6.02,14.016,20.012,23]tricosa-8(23),9,11,21-tetraene-17,19-dione.
| Compound Name | (1S,2S,6R,14R,15R)-11,15-dimethoxy-18-(4-methoxyphenyl)-5-methyl-13-oxa-5,18-diazaheptacyclo[13.5.2.12,8.01,6.02,14.016,20.012,23]tricosa-8(23),9,11,21-tetraene-17,19-dione |
|---|---|
| PubChem CID | 100946585 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (1S,2S,6R,14R,15R)-11,15-dimethoxy-18-(4-methoxyphenyl)-5-methyl-13-oxa-5,18-diazaheptacyclo[13.5.2.12,8.01,6.02,14.016,20.012,23]tricosa-8(23),9,11,21-tetraene-17,19-dione |
| SMILES | COc1ccc(N2C(=O)C3C(C2=O)[C@@]24C=C[C@]3(OC)[C@@H]3Oc5c(OC)ccc6c5[C@@]32CCN(C)[C@@H]4C6)cc1 |
| InChI | InChI=1S/C30H30N2O6/c1-31-14-13-29-21-16-5-10-19(36-3)24(21)38-27(29)30(37-4)12-11-28(29,20(31)15-16)22-23(30)26(34)32(25(22)33)17-6-8-18(35-2)9-7-17/h5-12,20,22-23,27H,13-15H2,1-4H3/t20-,22?,23?,27-,28+,29+,30-/m1/s1 |
| InChIKey | VVAYDOFAMFHDLE-GIASXGMSSA-N |
| XLogP | 2.72 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|