C17H19NO5S — CID 100949444
ethyl 2-[(4S,5R)-10-oxo-4-phenyl-2-sulfanylidene-1,3-dioxa-9-azaspiro[4.5]decan-9-yl]acetate (PubChem CID 100949444) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl 2-[(4S,5R)-10-oxo-4-phenyl-2-sulfanylidene-1,3-dioxa-9-azaspiro[4.5]decan-9-yl]acetate.
| Compound Name | ethyl 2-[(4S,5R)-10-oxo-4-phenyl-2-sulfanylidene-1,3-dioxa-9-azaspiro[4.5]decan-9-yl]acetate |
|---|---|
| PubChem CID | 100949444 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | ethyl 2-[(4S,5R)-10-oxo-4-phenyl-2-sulfanylidene-1,3-dioxa-9-azaspiro[4.5]decan-9-yl]acetate |
| SMILES | CCOC(=O)CN1CCC[C@]2(OC(=S)O[C@H]2c2ccccc2)C1=O |
| InChI | InChI=1S/C17H19NO5S/c1-2-21-13(19)11-18-10-6-9-17(15(18)20)14(22-16(24)23-17)12-7-4-3-5-8-12/h3-5,7-8,14H,2,6,9-11H2,1H3/t14-,17+/m0/s1 |
| InChIKey | AFPDDIVEGGTIRP-WMLDXEAASA-N |
| XLogP | 1.98 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|