C16H21F3O5S — CID 100950507
[(2R)-3,3,3-trifluoro-2-(oxan-2-yloxymethyl)propyl] 4-methylbenzenesulfonate (PubChem CID 100950507) has the molecular formula C16H21F3O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is [(2R)-3,3,3-trifluoro-2-(oxan-2-yloxymethyl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-3,3,3-trifluoro-2-(oxan-2-yloxymethyl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 100950507 |
| Molecular Formula | C16H21F3O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [(2R)-3,3,3-trifluoro-2-(oxan-2-yloxymethyl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(COC2CCCCO2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3O5S/c1-12-5-7-14(8-6-12)25(20,21)24-11-13(16(17,18)19)10-23-15-4-2-3-9-22-15/h5-8,13,15H,2-4,9-11H2,1H3 |
| InChIKey | OVSVHKOXHZQQFB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|