C19H24N2O6 — CID 100953049
[N,N'-di(propan-2-yl)carbamimidoyl] 5,7-dimethoxy-2-oxochromene-3-carboxylate (PubChem CID 100953049) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is [N,N'-di(propan-2-yl)carbamimidoyl] 5,7-dimethoxy-2-oxochromene-3-carboxylate.
| Compound Name | [N,N'-di(propan-2-yl)carbamimidoyl] 5,7-dimethoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 100953049 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [N,N'-di(propan-2-yl)carbamimidoyl] 5,7-dimethoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1cc(OC)c2cc(C(=O)O/C(=N/C(C)C)NC(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C19H24N2O6/c1-10(2)20-19(21-11(3)4)27-18(23)14-9-13-15(25-6)7-12(24-5)8-16(13)26-17(14)22/h7-11H,1-6H3,(H,20,21) |
| InChIKey | NIGDARLSYFQYIQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|