C19H12F3N3O2 — CID 100955441
ethyl 3-(4-cyanophenyl)-7-(trifluoromethyl)quinoxaline-2-carboxylate (PubChem CID 100955441) has the molecular formula C19H12F3N3O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is ethyl 3-(4-cyanophenyl)-7-(trifluoromethyl)quinoxaline-2-carboxylate.
| Compound Name | ethyl 3-(4-cyanophenyl)-7-(trifluoromethyl)quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 100955441 |
| Molecular Formula | C19H12F3N3O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | ethyl 3-(4-cyanophenyl)-7-(trifluoromethyl)quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cc(C(F)(F)F)ccc2nc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H12F3N3O2/c1-2-27-18(26)17-16(12-5-3-11(10-23)4-6-12)24-14-8-7-13(19(20,21)22)9-15(14)25-17/h3-9H,2H2,1H3 |
| InChIKey | KOXWXBWFVOCFCX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |