C18H23N3O9S — CID 10095623
[(2R,3S,4S,5S,6S)-4-acetyloxy-5-azido-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 10095623) has the molecular formula C18H23N3O9S and a molecular weight of 457.46 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-4-acetyloxy-5-azido-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S,6S)-4-acetyloxy-5-azido-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10095623 |
| Molecular Formula | C18H23N3O9S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-4-acetyloxy-5-azido-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C18H23N3O9S/c1-10-5-7-13(8-6-10)31(24,25)27-9-14-16(28-11(2)22)17(29-12(3)23)15(20-21-19)18(26-4)30-14/h5-8,14-18H,9H2,1-4H3/t14-,15+,16-,17+,18+/m1/s1 |
| InChIKey | LLMSRRWQJOBYNA-WKULXVSPSA-N |
| XLogP | 1.61 |
| TPSA | 163.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|